C22H17BrClN3O — CID 20877339
N-(4-bromo-3-methylphenyl)-2-(5-chloro-3-phenylindazol-1-yl)acetamide (PubChem CID 20877339) has the molecular formula C22H17BrClN3O and a molecular weight of 454.76 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-(5-chloro-3-phenylindazol-1-yl)acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-(5-chloro-3-phenylindazol-1-yl)acetamide |
|---|---|
| PubChem CID | 20877339 |
| Molecular Formula | C22H17BrClN3O |
| Molecular Weight | 454.76 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-(5-chloro-3-phenylindazol-1-yl)acetamide |
| SMILES | Cc1cc(NC(=O)Cn2nc(-c3ccccc3)c3cc(Cl)ccc32)ccc1Br |
| InChI | InChI=1S/C22H17BrClN3O/c1-14-11-17(8-9-19(14)23)25-21(28)13-27-20-10-7-16(24)12-18(20)22(26-27)15-5-3-2-4-6-15/h2-12H,13H2,1H3,(H,25,28) |
| InChIKey | WRSDTUMUEQBHLV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.76 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |