C19H20ClN3O — CID 6620038
N-butan-2-yl-2-(5-chloro-3-phenylindazol-1-yl)acetamide (PubChem CID 6620038) has the molecular formula C19H20ClN3O and a molecular weight of 341.84 g/mol. Its IUPAC name is N-butan-2-yl-2-(5-chloro-3-phenylindazol-1-yl)acetamide.
| Compound Name | N-butan-2-yl-2-(5-chloro-3-phenylindazol-1-yl)acetamide |
|---|---|
| PubChem CID | 6620038 |
| Molecular Formula | C19H20ClN3O |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-butan-2-yl-2-(5-chloro-3-phenylindazol-1-yl)acetamide |
| SMILES | CCC(C)NC(=O)Cn1nc(-c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H20ClN3O/c1-3-13(2)21-18(24)12-23-17-10-9-15(20)11-16(17)19(22-23)14-7-5-4-6-8-14/h4-11,13H,3,12H2,1-2H3,(H,21,24) |
| InChIKey | TXEOYRRYUQRREO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |