C24H28ClN3O — CID 20877509
4-(5-chloro-3-phenylindazol-1-yl)-N-cycloheptylbutanamide (PubChem CID 20877509) has the molecular formula C24H28ClN3O and a molecular weight of 409.96 g/mol. Its IUPAC name is 4-(5-chloro-3-phenylindazol-1-yl)-N-cycloheptylbutanamide.
| Compound Name | 4-(5-chloro-3-phenylindazol-1-yl)-N-cycloheptylbutanamide |
|---|---|
| PubChem CID | 20877509 |
| Molecular Formula | C24H28ClN3O |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 4-(5-chloro-3-phenylindazol-1-yl)-N-cycloheptylbutanamide |
| SMILES | O=C(CCCn1nc(-c2ccccc2)c2cc(Cl)ccc21)NC1CCCCCC1 |
| InChI | InChI=1S/C24H28ClN3O/c25-19-14-15-22-21(17-19)24(18-9-4-3-5-10-18)27-28(22)16-8-13-23(29)26-20-11-6-1-2-7-12-20/h3-5,9-10,14-15,17,20H,1-2,6-8,11-13,16H2,(H,26,29) |
| InChIKey | HRJKJKDUGQYGPD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |