C25H29ClN4O3 — CID 46259697
ethyl 4-[4-(5-chloro-3-phenylindazol-1-yl)butanoylamino]piperidine-1-carboxylate (PubChem CID 46259697) has the molecular formula C25H29ClN4O3 and a molecular weight of 468.99 g/mol. Its IUPAC name is ethyl 4-[4-(5-chloro-3-phenylindazol-1-yl)butanoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-(5-chloro-3-phenylindazol-1-yl)butanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46259697 |
| Molecular Formula | C25H29ClN4O3 |
| Molecular Weight | 468.99 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | ethyl 4-[4-(5-chloro-3-phenylindazol-1-yl)butanoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CCCn2nc(-c3ccccc3)c3cc(Cl)ccc32)CC1 |
| InChI | InChI=1S/C25H29ClN4O3/c1-2-33-25(32)29-15-12-20(13-16-29)27-23(31)9-6-14-30-22-11-10-19(26)17-21(22)24(28-30)18-7-4-3-5-8-18/h3-5,7-8,10-11,17,20H,2,6,9,12-16H2,1H3,(H,27,31) |
| InChIKey | RSAOZTINUCCPRU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.99 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |