C27H27ClN4O — CID 20877371
2-(5-chloro-3-phenylindazol-1-yl)-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]acetamide (PubChem CID 20877371) has the molecular formula C27H27ClN4O and a molecular weight of 458.99 g/mol. Its IUPAC name is 2-(5-chloro-3-phenylindazol-1-yl)-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]acetamide.
| Compound Name | 2-(5-chloro-3-phenylindazol-1-yl)-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]acetamide |
|---|---|
| PubChem CID | 20877371 |
| Molecular Formula | C27H27ClN4O |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 2-(5-chloro-3-phenylindazol-1-yl)-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]acetamide |
| SMILES | O=C(Cn1nc(-c2ccccc2)c2cc(Cl)ccc21)NCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C27H27ClN4O/c28-23-11-12-25-24(17-23)27(21-8-2-1-3-9-21)30-32(25)19-26(33)29-14-6-15-31-16-13-20-7-4-5-10-22(20)18-31/h1-5,7-12,17H,6,13-16,18-19H2,(H,29,33) |
| InChIKey | ILFFRQDWAUGGRH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|