C13H10N2O2S — CID 20885066
methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate (PubChem CID 20885066) has the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. Its IUPAC name is methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate.
| Compound Name | methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 20885066 |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate |
| SMILES | COC(=O)c1sc2cnccc2c1-n1cccc1 |
| InChI | InChI=1S/C13H10N2O2S/c1-17-13(16)12-11(15-6-2-3-7-15)9-4-5-14-8-10(9)18-12/h2-8H,1H3 |
| InChIKey | OPCPRVONCOYAEB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |