methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate

C13H10N2O2S — CID 20885066

IUPACmethyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate
SMILESCOC(=O)c1sc2cnccc2c1-n1cccc1
InChIInChI=1S/C13H10N2O2S/c1-17-13(16)12-11(15-6-2-3-7-15)9-4-5-14-8-10(9)18-12/h2-8H,1H3
InChIKeyOPCPRVONCOYAEB-UHFFFAOYSA-N
MW258.30 g/mol
LogP2.87
Rot. Bonds2

About methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate

methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate (PubChem CID 20885066) has the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. Its IUPAC name is methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate
PubChem CID20885066
Molecular FormulaC13H10N2O2S
Molecular Weight258.30 g/mol
Exact Mass258.05
IUPAC Namemethyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate
SMILESCOC(=O)c1sc2cnccc2c1-n1cccc1
InChIInChI=1S/C13H10N2O2S/c1-17-13(16)12-11(15-6-2-3-7-15)9-4-5-14-8-10(9)18-12/h2-8H,1H3
InChIKeyOPCPRVONCOYAEB-UHFFFAOYSA-N
XLogP2.87
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.30
LogP ≤ 52.87
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate?
The IUPAC name of methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate (CID 20885066) is methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate.
What is the SMILES notation for methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate?
The canonical SMILES for methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate is COC(=O)c1sc2cnccc2c1-n1cccc1.
What is the InChIKey of methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate?
The InChIKey is OPCPRVONCOYAEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O2S/c1-17-13(16)12-11(15-6-2-3-7-15)9-4-5-14-8-10(9)18-12/h2-8H,1H3.
What are the key properties of methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate?
methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate has a molecular weight of 258.30 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-pyrrol-1-ylthieno[2,3-c]pyridine-2-carboxylate is sourced from PubChem (CID 20885066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).