C20H26N2O4S3 — CID 20888766
N-[2-(cyclohexen-1-yl)ethyl]-2-ethylsulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-5-amine (PubChem CID 20888766) has the molecular formula C20H26N2O4S3 and a molecular weight of 454.64 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-ethylsulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-5-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-ethylsulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 20888766 |
| Molecular Formula | C20H26N2O4S3 |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-ethylsulfonyl-4-(4-methylphenyl)sulfonyl-1,3-thiazol-5-amine |
| SMILES | CCS(=O)(=O)c1nc(S(=O)(=O)c2ccc(C)cc2)c(NCCC2=CCCCC2)s1 |
| InChI | InChI=1S/C20H26N2O4S3/c1-3-28(23,24)20-22-19(29(25,26)17-11-9-15(2)10-12-17)18(27-20)21-14-13-16-7-5-4-6-8-16/h7,9-12,21H,3-6,8,13-14H2,1-2H3 |
| InChIKey | ADPDQQQKCPWBKE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|