C23H27N3O5S3 — CID 23607465
2-(benzenesulfonyl)-4-(4-methylphenyl)sulfonyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-5-amine (PubChem CID 23607465) has the molecular formula C23H27N3O5S3 and a molecular weight of 521.69 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-4-(4-methylphenyl)sulfonyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-5-amine.
| Compound Name | 2-(benzenesulfonyl)-4-(4-methylphenyl)sulfonyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 23607465 |
| Molecular Formula | C23H27N3O5S3 |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 2-(benzenesulfonyl)-4-(4-methylphenyl)sulfonyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-5-amine |
| SMILES | Cc1ccc(S(=O)(=O)c2nc(S(=O)(=O)c3ccccc3)sc2NCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C23H27N3O5S3/c1-18-8-10-20(11-9-18)33(27,28)22-21(24-12-5-13-26-14-16-31-17-15-26)32-23(25-22)34(29,30)19-6-3-2-4-7-19/h2-4,6-11,24H,5,12-17H2,1H3 |
| InChIKey | VSXFKEBDHLWGLU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|