C22H26N2O4S3 — CID 20888868
4-(4-methylphenyl)sulfonyl-N-(3-phenylpropyl)-2-propylsulfonyl-1,3-thiazol-5-amine (PubChem CID 20888868) has the molecular formula C22H26N2O4S3 and a molecular weight of 478.66 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyl-N-(3-phenylpropyl)-2-propylsulfonyl-1,3-thiazol-5-amine.
| Compound Name | 4-(4-methylphenyl)sulfonyl-N-(3-phenylpropyl)-2-propylsulfonyl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 20888868 |
| Molecular Formula | C22H26N2O4S3 |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyl-N-(3-phenylpropyl)-2-propylsulfonyl-1,3-thiazol-5-amine |
| SMILES | CCCS(=O)(=O)c1nc(S(=O)(=O)c2ccc(C)cc2)c(NCCCc2ccccc2)s1 |
| InChI | InChI=1S/C22H26N2O4S3/c1-3-16-30(25,26)22-24-21(31(27,28)19-13-11-17(2)12-14-19)20(29-22)23-15-7-10-18-8-5-4-6-9-18/h4-6,8-9,11-14,23H,3,7,10,15-16H2,1-2H3 |
| InChIKey | ZELPJKXBXPWMSH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|