C15H20N2O5S3 — CID 20888758
2-ethylsulfonyl-N-(2-methoxyethyl)-4-(4-methylphenyl)sulfonyl-1,3-thiazol-5-amine (PubChem CID 20888758) has the molecular formula C15H20N2O5S3 and a molecular weight of 404.54 g/mol. Its IUPAC name is 2-ethylsulfonyl-N-(2-methoxyethyl)-4-(4-methylphenyl)sulfonyl-1,3-thiazol-5-amine.
| Compound Name | 2-ethylsulfonyl-N-(2-methoxyethyl)-4-(4-methylphenyl)sulfonyl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 20888758 |
| Molecular Formula | C15H20N2O5S3 |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 2-ethylsulfonyl-N-(2-methoxyethyl)-4-(4-methylphenyl)sulfonyl-1,3-thiazol-5-amine |
| SMILES | CCS(=O)(=O)c1nc(S(=O)(=O)c2ccc(C)cc2)c(NCCOC)s1 |
| InChI | InChI=1S/C15H20N2O5S3/c1-4-24(18,19)15-17-14(13(23-15)16-9-10-22-3)25(20,21)12-7-5-11(2)6-8-12/h5-8,16H,4,9-10H2,1-3H3 |
| InChIKey | GTKUJJAUFZCCHN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|