C26H22BrN3O2 — CID 20890461
[4,4-bis(1H-indol-3-yl)piperidin-1-yl]-(5-bromofuran-2-yl)methanone (PubChem CID 20890461) has the molecular formula C26H22BrN3O2 and a molecular weight of 488.39 g/mol. Its IUPAC name is [4,4-bis(1H-indol-3-yl)piperidin-1-yl]-(5-bromofuran-2-yl)methanone.
| Compound Name | [4,4-bis(1H-indol-3-yl)piperidin-1-yl]-(5-bromofuran-2-yl)methanone |
|---|---|
| PubChem CID | 20890461 |
| Molecular Formula | C26H22BrN3O2 |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | [4,4-bis(1H-indol-3-yl)piperidin-1-yl]-(5-bromofuran-2-yl)methanone |
| SMILES | O=C(c1ccc(Br)o1)N1CCC(c2c[nH]c3ccccc23)(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C26H22BrN3O2/c27-24-10-9-23(32-24)25(31)30-13-11-26(12-14-30,19-15-28-21-7-3-1-5-17(19)21)20-16-29-22-8-4-2-6-18(20)22/h1-10,15-16,28-29H,11-14H2 |
| InChIKey | ATBWTWSNOFJNAO-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 65.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |