C21H16N2O6 — CID 2089454
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(4-methyl-2-oxochromen-7-yl)oxyacetate (PubChem CID 2089454) has the molecular formula C21H16N2O6 and a molecular weight of 392.37 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(4-methyl-2-oxochromen-7-yl)oxyacetate.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 2089454 |
| Molecular Formula | C21H16N2O6 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)OCc3nnc(-c4ccccc4)o3)ccc12 |
| InChI | InChI=1S/C21H16N2O6/c1-13-9-19(24)28-17-10-15(7-8-16(13)17)26-12-20(25)27-11-18-22-23-21(29-18)14-5-3-2-4-6-14/h2-10H,11-12H2,1H3 |
| InChIKey | BKVWKJGNLCWZBA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 104.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|