C22H18N2O3 — CID 4567382
(4-phenylmethoxyphenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methanol (PubChem CID 4567382) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is (4-phenylmethoxyphenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methanol.
| Compound Name | (4-phenylmethoxyphenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methanol |
|---|---|
| PubChem CID | 4567382 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (4-phenylmethoxyphenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methanol |
| SMILES | OC(c1ccc(OCc2ccccc2)cc1)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C22H18N2O3/c25-20(22-24-23-21(27-22)18-9-5-2-6-10-18)17-11-13-19(14-12-17)26-15-16-7-3-1-4-8-16/h1-14,20,25H,15H2 |
| InChIKey | WNLSGAAZWQWYGD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |