C17H11N3O3S — CID 20897494
N-(2,1,3-benzothiadiazol-5-yl)-6-methyl-4-oxochromene-2-carboxamide (PubChem CID 20897494) has the molecular formula C17H11N3O3S and a molecular weight of 337.36 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-5-yl)-6-methyl-4-oxochromene-2-carboxamide.
| Compound Name | N-(2,1,3-benzothiadiazol-5-yl)-6-methyl-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 20897494 |
| Molecular Formula | C17H11N3O3S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-5-yl)-6-methyl-4-oxochromene-2-carboxamide |
| SMILES | Cc1ccc2oc(C(=O)Nc3ccc4nsnc4c3)cc(=O)c2c1 |
| InChI | InChI=1S/C17H11N3O3S/c1-9-2-5-15-11(6-9)14(21)8-16(23-15)17(22)18-10-3-4-12-13(7-10)20-24-19-12/h2-8H,1H3,(H,18,22) |
| InChIKey | HRNNQGFCEBSPCQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |