C19H18FN3O4S — CID 20903526
N-(3-fluoro-4-methylphenyl)-2-[methyl-[(2-oxo-1H-quinolin-6-yl)sulfonyl]amino]acetamide (PubChem CID 20903526) has the molecular formula C19H18FN3O4S and a molecular weight of 403.44 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-2-[methyl-[(2-oxo-1H-quinolin-6-yl)sulfonyl]amino]acetamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-2-[methyl-[(2-oxo-1H-quinolin-6-yl)sulfonyl]amino]acetamide |
|---|---|
| PubChem CID | 20903526 |
| Molecular Formula | C19H18FN3O4S |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-2-[methyl-[(2-oxo-1H-quinolin-6-yl)sulfonyl]amino]acetamide |
| SMILES | Cc1ccc(NC(=O)CN(C)S(=O)(=O)c2ccc3[nH]c(=O)ccc3c2)cc1F |
| InChI | InChI=1S/C19H18FN3O4S/c1-12-3-5-14(10-16(12)20)21-19(25)11-23(2)28(26,27)15-6-7-17-13(9-15)4-8-18(24)22-17/h3-10H,11H2,1-2H3,(H,21,25)(H,22,24) |
| InChIKey | RWWGQBWYPWXHRS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |