C19H25N3O4S — CID 20903521
N-(4-methylcyclohexyl)-2-[methyl-[(2-oxo-1H-quinolin-6-yl)sulfonyl]amino]acetamide (PubChem CID 20903521) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-2-[methyl-[(2-oxo-1H-quinolin-6-yl)sulfonyl]amino]acetamide.
| Compound Name | N-(4-methylcyclohexyl)-2-[methyl-[(2-oxo-1H-quinolin-6-yl)sulfonyl]amino]acetamide |
|---|---|
| PubChem CID | 20903521 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-(4-methylcyclohexyl)-2-[methyl-[(2-oxo-1H-quinolin-6-yl)sulfonyl]amino]acetamide |
| SMILES | CC1CCC(NC(=O)CN(C)S(=O)(=O)c2ccc3[nH]c(=O)ccc3c2)CC1 |
| InChI | InChI=1S/C19H25N3O4S/c1-13-3-6-15(7-4-13)20-19(24)12-22(2)27(25,26)16-8-9-17-14(11-16)5-10-18(23)21-17/h5,8-11,13,15H,3-4,6-7,12H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | UWCUKSIAYAIUTB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |