C25H29N3O4S — CID 20909641
ethyl 1-acetamido-3-[2-(2,4-dimethylanilino)-2-oxoethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyrrole-2-carboxylate (PubChem CID 20909641) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is ethyl 1-acetamido-3-[2-(2,4-dimethylanilino)-2-oxoethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyrrole-2-carboxylate.
| Compound Name | ethyl 1-acetamido-3-[2-(2,4-dimethylanilino)-2-oxoethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 20909641 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | ethyl 1-acetamido-3-[2-(2,4-dimethylanilino)-2-oxoethyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(C)=O)c2c3c(sc2n1CC(=O)Nc1ccc(C)cc1C)CCCC3 |
| InChI | InChI=1S/C25H29N3O4S/c1-5-32-25(31)23-22(26-16(4)29)21-17-8-6-7-9-19(17)33-24(21)28(23)13-20(30)27-18-11-10-14(2)12-15(18)3/h10-12H,5-9,13H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | FULIRAHSFFPWAT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |