C28H31N3O3S — CID 20933895
ethyl 2-[3-[2-(2,4-dimethylanilino)-2-oxoethyl]-1-pyrrol-1-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyrrol-2-yl]acetate (PubChem CID 20933895) has the molecular formula C28H31N3O3S and a molecular weight of 489.64 g/mol. Its IUPAC name is ethyl 2-[3-[2-(2,4-dimethylanilino)-2-oxoethyl]-1-pyrrol-1-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyrrol-2-yl]acetate.
| Compound Name | ethyl 2-[3-[2-(2,4-dimethylanilino)-2-oxoethyl]-1-pyrrol-1-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyrrol-2-yl]acetate |
|---|---|
| PubChem CID | 20933895 |
| Molecular Formula | C28H31N3O3S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | ethyl 2-[3-[2-(2,4-dimethylanilino)-2-oxoethyl]-1-pyrrol-1-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyrrol-2-yl]acetate |
| SMILES | CCOC(=O)Cc1c(-n2cccc2)c2c3c(sc2n1CC(=O)Nc1ccc(C)cc1C)CCCC3 |
| InChI | InChI=1S/C28H31N3O3S/c1-4-34-25(33)16-22-27(30-13-7-8-14-30)26-20-9-5-6-10-23(20)35-28(26)31(22)17-24(32)29-21-12-11-18(2)15-19(21)3/h7-8,11-15H,4-6,9-10,16-17H2,1-3H3,(H,29,32) |
| InChIKey | MNENVOXMEWQGHX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |