C20H22N2O2S — CID 20909731
N-(2-ethylphenyl)-6,7,8,9-tetrahydro-5H-carbazole-3-sulfonamide (PubChem CID 20909731) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is N-(2-ethylphenyl)-6,7,8,9-tetrahydro-5H-carbazole-3-sulfonamide.
| Compound Name | N-(2-ethylphenyl)-6,7,8,9-tetrahydro-5H-carbazole-3-sulfonamide |
|---|---|
| PubChem CID | 20909731 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-(2-ethylphenyl)-6,7,8,9-tetrahydro-5H-carbazole-3-sulfonamide |
| SMILES | CCc1ccccc1NS(=O)(=O)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C20H22N2O2S/c1-2-14-7-3-5-9-18(14)22-25(23,24)15-11-12-20-17(13-15)16-8-4-6-10-19(16)21-20/h3,5,7,9,11-13,21-22H,2,4,6,8,10H2,1H3 |
| InChIKey | NBPMYQIXBQEGQV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|