C19H17F3N2O3S — CID 46276106
N-[4-(trifluoromethoxy)phenyl]-6,7,8,9-tetrahydro-5H-carbazole-3-sulfonamide (PubChem CID 46276106) has the molecular formula C19H17F3N2O3S and a molecular weight of 410.42 g/mol. Its IUPAC name is N-[4-(trifluoromethoxy)phenyl]-6,7,8,9-tetrahydro-5H-carbazole-3-sulfonamide.
| Compound Name | N-[4-(trifluoromethoxy)phenyl]-6,7,8,9-tetrahydro-5H-carbazole-3-sulfonamide |
|---|---|
| PubChem CID | 46276106 |
| Molecular Formula | C19H17F3N2O3S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-[4-(trifluoromethoxy)phenyl]-6,7,8,9-tetrahydro-5H-carbazole-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(OC(F)(F)F)cc1)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C19H17F3N2O3S/c20-19(21,22)27-13-7-5-12(6-8-13)24-28(25,26)14-9-10-18-16(11-14)15-3-1-2-4-17(15)23-18/h5-11,23-24H,1-4H2 |
| InChIKey | SPCBSSJNVBRVOD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|