C21H24N2O2S — CID 20970048
N-(3-ethylphenyl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-2-sulfonamide (PubChem CID 20970048) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is N-(3-ethylphenyl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-2-sulfonamide.
| Compound Name | N-(3-ethylphenyl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-2-sulfonamide |
|---|---|
| PubChem CID | 20970048 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-(3-ethylphenyl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-2-sulfonamide |
| SMILES | CCc1cccc(NS(=O)(=O)c2ccc3[nH]c4c(c3c2)CCCCC4)c1 |
| InChI | InChI=1S/C21H24N2O2S/c1-2-15-7-6-8-16(13-15)23-26(24,25)17-11-12-21-19(14-17)18-9-4-3-5-10-20(18)22-21/h6-8,11-14,22-23H,2-5,9-10H2,1H3 |
| InChIKey | RMZDVBFTJGKABR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|