C21H23NO3S2 — CID 20913417
N-(2,4-dimethoxyphenyl)-7-methyl-6,7,8,9-tetrahydro-1H-thiopyrano[4,3-b][1]benzothiole-3-carboxamide (PubChem CID 20913417) has the molecular formula C21H23NO3S2 and a molecular weight of 401.55 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-7-methyl-6,7,8,9-tetrahydro-1H-thiopyrano[4,3-b][1]benzothiole-3-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-7-methyl-6,7,8,9-tetrahydro-1H-thiopyrano[4,3-b][1]benzothiole-3-carboxamide |
|---|---|
| PubChem CID | 20913417 |
| Molecular Formula | C21H23NO3S2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-7-methyl-6,7,8,9-tetrahydro-1H-thiopyrano[4,3-b][1]benzothiole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2=Cc3sc4c(c3CS2)CCC(C)C4)c(OC)c1 |
| InChI | InChI=1S/C21H23NO3S2/c1-12-4-6-14-15-11-26-20(10-19(15)27-18(14)8-12)21(23)22-16-7-5-13(24-2)9-17(16)25-3/h5,7,9-10,12H,4,6,8,11H2,1-3H3,(H,22,23) |
| InChIKey | YWASDBIEYGBNEI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |