C23H27NO3S2 — CID 92690157
(7R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-7-methyl-6,7,8,9-tetrahydro-1H-thiopyrano[4,3-b][1]benzothiole-3-carboxamide (PubChem CID 92690157) has the molecular formula C23H27NO3S2 and a molecular weight of 429.61 g/mol. Its IUPAC name is (7R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-7-methyl-6,7,8,9-tetrahydro-1H-thiopyrano[4,3-b][1]benzothiole-3-carboxamide.
| Compound Name | (7R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-7-methyl-6,7,8,9-tetrahydro-1H-thiopyrano[4,3-b][1]benzothiole-3-carboxamide |
|---|---|
| PubChem CID | 92690157 |
| Molecular Formula | C23H27NO3S2 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (7R)-N-[2-(3,4-dimethoxyphenyl)ethyl]-7-methyl-6,7,8,9-tetrahydro-1H-thiopyrano[4,3-b][1]benzothiole-3-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2=Cc3sc4c(c3CS2)CC[C@@H](C)C4)cc1OC |
| InChI | InChI=1S/C23H27NO3S2/c1-14-4-6-16-17-13-28-22(12-21(17)29-20(16)10-14)23(25)24-9-8-15-5-7-18(26-2)19(11-15)27-3/h5,7,11-12,14H,4,6,8-10,13H2,1-3H3,(H,24,25)/t14-/m1/s1 |
| InChIKey | WZIJKTSGHMXMQI-CQSZACIVSA-N |
| XLogP | 4.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |