C24H22N4O — CID 20916124
[4-(2-phenylimidazo[4,5-b]pyridin-3-yl)phenyl]-piperidin-1-ylmethanone (PubChem CID 20916124) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is [4-(2-phenylimidazo[4,5-b]pyridin-3-yl)phenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-(2-phenylimidazo[4,5-b]pyridin-3-yl)phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 20916124 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | [4-(2-phenylimidazo[4,5-b]pyridin-3-yl)phenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(-n2c(-c3ccccc3)nc3cccnc32)cc1)N1CCCCC1 |
| InChI | InChI=1S/C24H22N4O/c29-24(27-16-5-2-6-17-27)19-11-13-20(14-12-19)28-22(18-8-3-1-4-9-18)26-21-10-7-15-25-23(21)28/h1,3-4,7-15H,2,5-6,16-17H2 |
| InChIKey | CTYQLKYFOHBAGK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |