C14H16N2O2S — CID 20920679
(4-methyl-1,4-benzothiazin-2-yl)-morpholin-4-ylmethanone (PubChem CID 20920679) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is (4-methyl-1,4-benzothiazin-2-yl)-morpholin-4-ylmethanone.
| Compound Name | (4-methyl-1,4-benzothiazin-2-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 20920679 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (4-methyl-1,4-benzothiazin-2-yl)-morpholin-4-ylmethanone |
| SMILES | CN1C=C(C(=O)N2CCOCC2)Sc2ccccc21 |
| InChI | InChI=1S/C14H16N2O2S/c1-15-10-13(14(17)16-6-8-18-9-7-16)19-12-5-3-2-4-11(12)15/h2-5,10H,6-9H2,1H3 |
| InChIKey | VIEJLIVJWLPKLF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|