C22H28N4O2S2 — CID 20921288
N-[4-[2-oxo-2-(3-propylsulfanylpropylamino)ethyl]phenyl]-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide (PubChem CID 20921288) has the molecular formula C22H28N4O2S2 and a molecular weight of 444.63 g/mol. Its IUPAC name is N-[4-[2-oxo-2-(3-propylsulfanylpropylamino)ethyl]phenyl]-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide.
| Compound Name | N-[4-[2-oxo-2-(3-propylsulfanylpropylamino)ethyl]phenyl]-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide |
|---|---|
| PubChem CID | 20921288 |
| Molecular Formula | C22H28N4O2S2 |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | N-[4-[2-oxo-2-(3-propylsulfanylpropylamino)ethyl]phenyl]-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide |
| SMILES | CCCSCCCNC(=O)Cc1ccc(NC(=O)N2CCSc3ncccc32)cc1 |
| InChI | InChI=1S/C22H28N4O2S2/c1-2-13-29-14-4-11-23-20(27)16-17-6-8-18(9-7-17)25-22(28)26-12-15-30-21-19(26)5-3-10-24-21/h3,5-10H,2,4,11-16H2,1H3,(H,23,27)(H,25,28) |
| InChIKey | TVRVTIJLAVTNMO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|