C26H26N4O2S — CID 92691884
N-[4-[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]phenyl]-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide (PubChem CID 92691884) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is N-[4-[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]phenyl]-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide.
| Compound Name | N-[4-[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]phenyl]-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide |
|---|---|
| PubChem CID | 92691884 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-[4-[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]phenyl]-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide |
| SMILES | O=C(Cc1ccc(NC(=O)N2CCSc3ncccc32)cc1)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C26H26N4O2S/c31-24(29-22-8-3-6-19-5-1-2-7-21(19)22)17-18-10-12-20(13-11-18)28-26(32)30-15-16-33-25-23(30)9-4-14-27-25/h1-2,4-5,7,9-14,22H,3,6,8,15-17H2,(H,28,32)(H,29,31)/t22-/m1/s1 |
| InChIKey | WILYQNMPRMDYLA-JOCHJYFZSA-N |
| XLogP | 4.96 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |