C22H21N3OS2 — CID 20951569
5-(2,3-dihydropyrido[2,3-b][1,4]thiazin-1-yl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)thiophene-2-carboxamide (PubChem CID 20951569) has the molecular formula C22H21N3OS2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 5-(2,3-dihydropyrido[2,3-b][1,4]thiazin-1-yl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)thiophene-2-carboxamide.
| Compound Name | 5-(2,3-dihydropyrido[2,3-b][1,4]thiazin-1-yl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 20951569 |
| Molecular Formula | C22H21N3OS2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 5-(2,3-dihydropyrido[2,3-b][1,4]thiazin-1-yl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)thiophene-2-carboxamide |
| SMILES | O=C(NC1CCCc2ccccc21)c1ccc(N2CCSc3ncccc32)s1 |
| InChI | InChI=1S/C22H21N3OS2/c26-21(24-17-8-3-6-15-5-1-2-7-16(15)17)19-10-11-20(28-19)25-13-14-27-22-18(25)9-4-12-23-22/h1-2,4-5,7,9-12,17H,3,6,8,13-14H2,(H,24,26) |
| InChIKey | SYUQXXSSAABYRH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |