C16H16NO3S2- — CID 6930464
6-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-2,3-dihydro-1,4-dithiine-5-carboxylate (PubChem CID 6930464) has the molecular formula C16H16NO3S2- and a molecular weight of 334.44 g/mol. Its IUPAC name is 6-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-2,3-dihydro-1,4-dithiine-5-carboxylate.
| Compound Name | 6-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-2,3-dihydro-1,4-dithiine-5-carboxylate |
|---|---|
| PubChem CID | 6930464 |
| Molecular Formula | C16H16NO3S2- |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 6-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]-2,3-dihydro-1,4-dithiine-5-carboxylate |
| SMILES | O=C([O-])C1=C(C(=O)N[C@@H]2CCCc3ccccc32)SCCS1 |
| InChI | InChI=1S/C16H17NO3S2/c18-15(13-14(16(19)20)22-9-8-21-13)17-12-7-3-5-10-4-1-2-6-11(10)12/h1-2,4,6,12H,3,5,7-9H2,(H,17,18)(H,19,20)/p-1/t12-/m1/s1 |
| InChIKey | LHFQCAHMGPGVSS-GFCCVEGCSA-M |
| XLogP | 1.62 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |