C16H19N3OS2 — CID 20951584
N-butyl-5-(2,3-dihydropyrido[2,3-b][1,4]thiazin-1-yl)thiophene-2-carboxamide (PubChem CID 20951584) has the molecular formula C16H19N3OS2 and a molecular weight of 333.48 g/mol. Its IUPAC name is N-butyl-5-(2,3-dihydropyrido[2,3-b][1,4]thiazin-1-yl)thiophene-2-carboxamide.
| Compound Name | N-butyl-5-(2,3-dihydropyrido[2,3-b][1,4]thiazin-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 20951584 |
| Molecular Formula | C16H19N3OS2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N-butyl-5-(2,3-dihydropyrido[2,3-b][1,4]thiazin-1-yl)thiophene-2-carboxamide |
| SMILES | CCCCNC(=O)c1ccc(N2CCSc3ncccc32)s1 |
| InChI | InChI=1S/C16H19N3OS2/c1-2-3-8-17-15(20)13-6-7-14(22-13)19-10-11-21-16-12(19)5-4-9-18-16/h4-7,9H,2-3,8,10-11H2,1H3,(H,17,20) |
| InChIKey | OIFQSWAIQLTFJB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|