C23H29N5O3S — CID 20921259
N-[4-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]phenyl]-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide (PubChem CID 20921259) has the molecular formula C23H29N5O3S and a molecular weight of 455.58 g/mol. Its IUPAC name is N-[4-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]phenyl]-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide.
| Compound Name | N-[4-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]phenyl]-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide |
|---|---|
| PubChem CID | 20921259 |
| Molecular Formula | C23H29N5O3S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-[4-[2-(3-morpholin-4-ylpropylamino)-2-oxoethyl]phenyl]-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide |
| SMILES | O=C(Cc1ccc(NC(=O)N2CCSc3ncccc32)cc1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C23H29N5O3S/c29-21(24-9-2-10-27-11-14-31-15-12-27)17-18-4-6-19(7-5-18)26-23(30)28-13-16-32-22-20(28)3-1-8-25-22/h1,3-8H,2,9-17H2,(H,24,29)(H,26,30) |
| InChIKey | CFANHEAVNXJRQH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|