C18H26N4O3S — CID 20890074
N-(3-morpholin-4-ylpropyl)-4-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)butanamide (PubChem CID 20890074) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-4-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)butanamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-4-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)butanamide |
|---|---|
| PubChem CID | 20890074 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-4-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)CSc2ncccc21)NCCCN1CCOCC1 |
| InChI | InChI=1S/C18H26N4O3S/c23-16(19-7-3-8-21-10-12-25-13-11-21)5-2-9-22-15-4-1-6-20-18(15)26-14-17(22)24/h1,4,6H,2-3,5,7-14H2,(H,19,23) |
| InChIKey | MINIHCGWJZOKGR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|