C17H25N3O3S — CID 46261547
4-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)-N-(3-propan-2-yloxypropyl)butanamide (PubChem CID 46261547) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 4-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)-N-(3-propan-2-yloxypropyl)butanamide.
| Compound Name | 4-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)-N-(3-propan-2-yloxypropyl)butanamide |
|---|---|
| PubChem CID | 46261547 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 4-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)-N-(3-propan-2-yloxypropyl)butanamide |
| SMILES | CC(C)OCCCNC(=O)CCCN1C(=O)CSc2ncccc21 |
| InChI | InChI=1S/C17H25N3O3S/c1-13(2)23-11-5-9-18-15(21)7-4-10-20-14-6-3-8-19-17(14)24-12-16(20)22/h3,6,8,13H,4-5,7,9-12H2,1-2H3,(H,18,21) |
| InChIKey | VJWIYUIBGIUTQQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|