C17H17N3O2S — CID 46277515
N-ethyl-4-[(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)methyl]benzamide (PubChem CID 46277515) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-ethyl-4-[(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)methyl]benzamide.
| Compound Name | N-ethyl-4-[(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 46277515 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-ethyl-4-[(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)methyl]benzamide |
| SMILES | CCNC(=O)c1ccc(CN2C(=O)CSc3ncccc32)cc1 |
| InChI | InChI=1S/C17H17N3O2S/c1-2-18-16(22)13-7-5-12(6-8-13)10-20-14-4-3-9-19-17(14)23-11-15(20)21/h3-9H,2,10-11H2,1H3,(H,18,22) |
| InChIKey | XJKWSFHPQDDIAY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |