C18H19N3O2S — CID 6625425
N-benzyl-4-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)butanamide (PubChem CID 6625425) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is N-benzyl-4-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)butanamide.
| Compound Name | N-benzyl-4-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)butanamide |
|---|---|
| PubChem CID | 6625425 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-benzyl-4-(2-oxopyrido[2,3-b][1,4]thiazin-1-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)CSc2ncccc21)NCc1ccccc1 |
| InChI | InChI=1S/C18H19N3O2S/c22-16(20-12-14-6-2-1-3-7-14)9-5-11-21-15-8-4-10-19-18(15)24-13-17(21)23/h1-4,6-8,10H,5,9,11-13H2,(H,20,22) |
| InChIKey | BMNOZFBGGYNIII-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |