C22H24N6O — CID 20927487
3-ethyl-5-[4-(4-methoxyphenyl)piperazin-1-yl]-[1,2,4]triazolo[4,3-c]quinazoline (PubChem CID 20927487) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is 3-ethyl-5-[4-(4-methoxyphenyl)piperazin-1-yl]-[1,2,4]triazolo[4,3-c]quinazoline.
| Compound Name | 3-ethyl-5-[4-(4-methoxyphenyl)piperazin-1-yl]-[1,2,4]triazolo[4,3-c]quinazoline |
|---|---|
| PubChem CID | 20927487 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 3-ethyl-5-[4-(4-methoxyphenyl)piperazin-1-yl]-[1,2,4]triazolo[4,3-c]quinazoline |
| SMILES | CCc1nnc2c3ccccc3nc(N3CCN(c4ccc(OC)cc4)CC3)n12 |
| InChI | InChI=1S/C22H24N6O/c1-3-20-24-25-21-18-6-4-5-7-19(18)23-22(28(20)21)27-14-12-26(13-15-27)16-8-10-17(29-2)11-9-16/h4-11H,3,12-15H2,1-2H3 |
| InChIKey | KNJPOUHQUIDNEC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|