C22H25N3O — CID 20933767
N-[3-[2-(1H-benzimidazol-2-yl)ethyl]phenyl]cyclohexanecarboxamide (PubChem CID 20933767) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[3-[2-(1H-benzimidazol-2-yl)ethyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[2-(1H-benzimidazol-2-yl)ethyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 20933767 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-[3-[2-(1H-benzimidazol-2-yl)ethyl]phenyl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1cccc(CCc2nc3ccccc3[nH]2)c1)C1CCCCC1 |
| InChI | InChI=1S/C22H25N3O/c26-22(17-8-2-1-3-9-17)23-18-10-6-7-16(15-18)13-14-21-24-19-11-4-5-12-20(19)25-21/h4-7,10-12,15,17H,1-3,8-9,13-14H2,(H,23,26)(H,24,25) |
| InChIKey | AGMXPALQQYKLQQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |