C19H22N2O2 — CID 20940113
1-ethyl-2,3-dimethyl-N-[(5-methylfuran-2-yl)methyl]indole-5-carboxamide (PubChem CID 20940113) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethyl-N-[(5-methylfuran-2-yl)methyl]indole-5-carboxamide.
| Compound Name | 1-ethyl-2,3-dimethyl-N-[(5-methylfuran-2-yl)methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 20940113 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-ethyl-2,3-dimethyl-N-[(5-methylfuran-2-yl)methyl]indole-5-carboxamide |
| SMILES | CCn1c(C)c(C)c2cc(C(=O)NCc3ccc(C)o3)ccc21 |
| InChI | InChI=1S/C19H22N2O2/c1-5-21-14(4)13(3)17-10-15(7-9-18(17)21)19(22)20-11-16-8-6-12(2)23-16/h6-10H,5,11H2,1-4H3,(H,20,22) |
| InChIKey | JCBDVANOTUFDJI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 47.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|