C19H18FNO4S2 — CID 20944614
ethyl 3-[(4-ethylphenyl)sulfamoyl]-4-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 20944614) has the molecular formula C19H18FNO4S2 and a molecular weight of 407.49 g/mol. Its IUPAC name is ethyl 3-[(4-ethylphenyl)sulfamoyl]-4-fluoro-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 3-[(4-ethylphenyl)sulfamoyl]-4-fluoro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 20944614 |
| Molecular Formula | C19H18FNO4S2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | ethyl 3-[(4-ethylphenyl)sulfamoyl]-4-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2cccc(F)c2c1S(=O)(=O)Nc1ccc(CC)cc1 |
| InChI | InChI=1S/C19H18FNO4S2/c1-3-12-8-10-13(11-9-12)21-27(23,24)18-16-14(20)6-5-7-15(16)26-17(18)19(22)25-4-2/h5-11,21H,3-4H2,1-2H3 |
| InChIKey | FVROLLIGDJIZLQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |