C18H16ClNO4S2 — CID 8721611
ethyl 3-[(3-chloro-4-methylphenyl)sulfamoyl]-1-benzothiophene-2-carboxylate (PubChem CID 8721611) has the molecular formula C18H16ClNO4S2 and a molecular weight of 409.92 g/mol. Its IUPAC name is ethyl 3-[(3-chloro-4-methylphenyl)sulfamoyl]-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 3-[(3-chloro-4-methylphenyl)sulfamoyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 8721611 |
| Molecular Formula | C18H16ClNO4S2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | ethyl 3-[(3-chloro-4-methylphenyl)sulfamoyl]-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2ccccc2c1S(=O)(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C18H16ClNO4S2/c1-3-24-18(21)16-17(13-6-4-5-7-15(13)25-16)26(22,23)20-12-9-8-11(2)14(19)10-12/h4-10,20H,3H2,1-2H3 |
| InChIKey | RLUDYQMDTOUFFM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |