C26H33N5O5S — CID 20946713
N-[4-[(1,4-dimethyl-2,3-dioxo-7-piperidin-1-ylquinoxalin-6-yl)sulfamoyl]phenyl]-3-methylbutanamide (PubChem CID 20946713) has the molecular formula C26H33N5O5S and a molecular weight of 527.65 g/mol. Its IUPAC name is N-[4-[(1,4-dimethyl-2,3-dioxo-7-piperidin-1-ylquinoxalin-6-yl)sulfamoyl]phenyl]-3-methylbutanamide.
| Compound Name | N-[4-[(1,4-dimethyl-2,3-dioxo-7-piperidin-1-ylquinoxalin-6-yl)sulfamoyl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 20946713 |
| Molecular Formula | C26H33N5O5S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | N-[4-[(1,4-dimethyl-2,3-dioxo-7-piperidin-1-ylquinoxalin-6-yl)sulfamoyl]phenyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(S(=O)(=O)Nc2cc3c(cc2N2CCCCC2)n(C)c(=O)c(=O)n3C)cc1 |
| InChI | InChI=1S/C26H33N5O5S/c1-17(2)14-24(32)27-18-8-10-19(11-9-18)37(35,36)28-20-15-22-23(30(4)26(34)25(33)29(22)3)16-21(20)31-12-6-5-7-13-31/h8-11,15-17,28H,5-7,12-14H2,1-4H3,(H,27,32) |
| InChIKey | KPGILPHVGWOKFS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|