C22H25FN4O4S — CID 22433280
N-(1,4-dimethyl-2,3-dioxo-7-piperidin-1-ylquinoxalin-6-yl)-4-fluoro-3-methylbenzenesulfonamide (PubChem CID 22433280) has the molecular formula C22H25FN4O4S and a molecular weight of 460.53 g/mol. Its IUPAC name is N-(1,4-dimethyl-2,3-dioxo-7-piperidin-1-ylquinoxalin-6-yl)-4-fluoro-3-methylbenzenesulfonamide.
| Compound Name | N-(1,4-dimethyl-2,3-dioxo-7-piperidin-1-ylquinoxalin-6-yl)-4-fluoro-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 22433280 |
| Molecular Formula | C22H25FN4O4S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | N-(1,4-dimethyl-2,3-dioxo-7-piperidin-1-ylquinoxalin-6-yl)-4-fluoro-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2cc3c(cc2N2CCCCC2)n(C)c(=O)c(=O)n3C)ccc1F |
| InChI | InChI=1S/C22H25FN4O4S/c1-14-11-15(7-8-16(14)23)32(30,31)24-17-12-19-20(26(3)22(29)21(28)25(19)2)13-18(17)27-9-5-4-6-10-27/h7-8,11-13,24H,4-6,9-10H2,1-3H3 |
| InChIKey | YSOOPGQBYBULGA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|