C17H26N4O3S — CID 20947071
N-[2-(cyclohexen-1-yl)ethyl]-2-(4-pyrrolidin-1-ylsulfonylimidazol-1-yl)acetamide (PubChem CID 20947071) has the molecular formula C17H26N4O3S and a molecular weight of 366.49 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(4-pyrrolidin-1-ylsulfonylimidazol-1-yl)acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(4-pyrrolidin-1-ylsulfonylimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 20947071 |
| Molecular Formula | C17H26N4O3S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(4-pyrrolidin-1-ylsulfonylimidazol-1-yl)acetamide |
| SMILES | O=C(Cn1cnc(S(=O)(=O)N2CCCC2)c1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C17H26N4O3S/c22-16(18-9-8-15-6-2-1-3-7-15)12-20-13-17(19-14-20)25(23,24)21-10-4-5-11-21/h6,13-14H,1-5,7-12H2,(H,18,22) |
| InChIKey | ARNOVCPJOJMXGM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|