C19H23BrN4O2S — CID 20947371
1-[6-(5-bromothiophen-2-yl)pyridazin-3-yl]-N-(oxolan-2-ylmethyl)piperidine-4-carboxamide (PubChem CID 20947371) has the molecular formula C19H23BrN4O2S and a molecular weight of 451.39 g/mol. Its IUPAC name is 1-[6-(5-bromothiophen-2-yl)pyridazin-3-yl]-N-(oxolan-2-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-[6-(5-bromothiophen-2-yl)pyridazin-3-yl]-N-(oxolan-2-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20947371 |
| Molecular Formula | C19H23BrN4O2S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 1-[6-(5-bromothiophen-2-yl)pyridazin-3-yl]-N-(oxolan-2-ylmethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCC1CCCO1)C1CCN(c2ccc(-c3ccc(Br)s3)nn2)CC1 |
| InChI | InChI=1S/C19H23BrN4O2S/c20-17-5-4-16(27-17)15-3-6-18(23-22-15)24-9-7-13(8-10-24)19(25)21-12-14-2-1-11-26-14/h3-6,13-14H,1-2,7-12H2,(H,21,25) |
| InChIKey | SJIOLQDJZYMODO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |