C16H24N4O3 — CID 20949001
4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(3-ethoxypropyl)-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 20949001) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(3-ethoxypropyl)-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(3-ethoxypropyl)-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 20949001 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 4-[(3,5-dimethylpyrazol-1-yl)methyl]-N-(3-ethoxypropyl)-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | CCOCCCNC(=O)c1noc(C)c1Cn1nc(C)cc1C |
| InChI | InChI=1S/C16H24N4O3/c1-5-22-8-6-7-17-16(21)15-14(13(4)23-19-15)10-20-12(3)9-11(2)18-20/h9H,5-8,10H2,1-4H3,(H,17,21) |
| InChIKey | KEMJVXHJRWUQJJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|