C13H18N6O4S3 — CID 20949840
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-morpholin-4-ylsulfonylimidazol-1-yl)acetamide (PubChem CID 20949840) has the molecular formula C13H18N6O4S3 and a molecular weight of 418.53 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-morpholin-4-ylsulfonylimidazol-1-yl)acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-morpholin-4-ylsulfonylimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 20949840 |
| Molecular Formula | C13H18N6O4S3 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-morpholin-4-ylsulfonylimidazol-1-yl)acetamide |
| SMILES | CCSc1nnc(NC(=O)Cn2cnc(S(=O)(=O)N3CCOCC3)c2)s1 |
| InChI | InChI=1S/C13H18N6O4S3/c1-2-24-13-17-16-12(25-13)15-10(20)7-18-8-11(14-9-18)26(21,22)19-3-5-23-6-4-19/h8-9H,2-7H2,1H3,(H,15,16,20) |
| InChIKey | CYUKPSGTQWHZQE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|