C17H18N6O3S3 — CID 20949960
2-[4-(2,3-dihydroindol-1-ylsulfonyl)imidazol-1-yl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 20949960) has the molecular formula C17H18N6O3S3 and a molecular weight of 450.57 g/mol. Its IUPAC name is 2-[4-(2,3-dihydroindol-1-ylsulfonyl)imidazol-1-yl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[4-(2,3-dihydroindol-1-ylsulfonyl)imidazol-1-yl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 20949960 |
| Molecular Formula | C17H18N6O3S3 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 2-[4-(2,3-dihydroindol-1-ylsulfonyl)imidazol-1-yl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCSc1nnc(NC(=O)Cn2cnc(S(=O)(=O)N3CCc4ccccc43)c2)s1 |
| InChI | InChI=1S/C17H18N6O3S3/c1-2-27-17-21-20-16(28-17)19-14(24)9-22-10-15(18-11-22)29(25,26)23-8-7-12-5-3-4-6-13(12)23/h3-6,10-11H,2,7-9H2,1H3,(H,19,20,24) |
| InChIKey | XEBUXUQULGCVRP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|