C28H24N4O5S3 — CID 3662218
methyl 4-[[5-[3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoylamino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate (PubChem CID 3662218) has the molecular formula C28H24N4O5S3 and a molecular weight of 592.72 g/mol. Its IUPAC name is methyl 4-[[5-[3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoylamino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[[5-[3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoylamino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 3662218 |
| Molecular Formula | C28H24N4O5S3 |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.09 |
| IUPAC Name | methyl 4-[[5-[3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoylamino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSc2nnc(NC(=O)C=Cc3ccc(S(=O)(=O)N4CCc5ccccc54)cc3)s2)cc1 |
| InChI | InChI=1S/C28H24N4O5S3/c1-37-26(34)22-11-6-20(7-12-22)18-38-28-31-30-27(39-28)29-25(33)15-10-19-8-13-23(14-9-19)40(35,36)32-17-16-21-4-2-3-5-24(21)32/h2-15H,16-18H2,1H3,(H,29,30,33) |
| InChIKey | XGNQFYDUPLOGBU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|