C16H27N3OS+2 — CID 2095477
methyl-(1-methylpiperidin-1-ium-4-yl)-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium (PubChem CID 2095477) has the molecular formula C16H27N3OS+2 and a molecular weight of 309.48 g/mol. Its IUPAC name is methyl-(1-methylpiperidin-1-ium-4-yl)-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium.
| Compound Name | methyl-(1-methylpiperidin-1-ium-4-yl)-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 2095477 |
| Molecular Formula | C16H27N3OS+2 |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | methyl-(1-methylpiperidin-1-ium-4-yl)-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium |
| SMILES | CSc1ccccc1NC(=O)C[NH+](C)C1CC[NH+](C)CC1 |
| InChI | InChI=1S/C16H25N3OS/c1-18-10-8-13(9-11-18)19(2)12-16(20)17-14-6-4-5-7-15(14)21-3/h4-7,13H,8-12H2,1-3H3,(H,17,20)/p+2 |
| InChIKey | SLGTVEQLQMNMDK-UHFFFAOYSA-P |
| XLogP | -0.46 |
| TPSA | 37.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |