C22H33N3OS — CID 2095668
2-[(5S)-2-cyclohexylimino-5-methyl-1,3-thiazolidin-3-yl]-N-(2,6-diethylphenyl)acetamide (PubChem CID 2095668) has the molecular formula C22H33N3OS and a molecular weight of 387.59 g/mol. Its IUPAC name is 2-[(5S)-2-cyclohexylimino-5-methyl-1,3-thiazolidin-3-yl]-N-(2,6-diethylphenyl)acetamide.
| Compound Name | 2-[(5S)-2-cyclohexylimino-5-methyl-1,3-thiazolidin-3-yl]-N-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 2095668 |
| Molecular Formula | C22H33N3OS |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-[(5S)-2-cyclohexylimino-5-methyl-1,3-thiazolidin-3-yl]-N-(2,6-diethylphenyl)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CN1C[C@H](C)S/C1=N\C1CCCCC1 |
| InChI | InChI=1S/C22H33N3OS/c1-4-17-10-9-11-18(5-2)21(17)24-20(26)15-25-14-16(3)27-22(25)23-19-12-7-6-8-13-19/h9-11,16,19H,4-8,12-15H2,1-3H3,(H,24,26)/b23-22-/t16-/m0/s1 |
| InChIKey | DCFKXXAVYVHYGX-GBWQBGJGSA-N |
| XLogP | 4.88 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|